CAS 1432681-60-1

Benzenepropanamine, α-(trifluoromethyl)-, hydrochloride (1:1)

Description:

Benzenepropanamine, α-(trifluoromethyl)-, hydrochloride (1:1), with the CAS number 1432681-60-1, is a chemical compound characterized by its structure, which includes a benzene ring, a propanamine chain, and a trifluoromethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications. The presence of the trifluoromethyl group imparts unique electronic properties, potentially influencing the compound's reactivity and interaction with biological systems. As a hydrochloride, it is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. However, detailed information regarding its toxicity, stability, and specific applications may require further investigation through scientific literature and safety data sheets.

Formula: C₁₀H₁₂F₃N·ClH

InChI: InChI=1S/C10H12F3N.ClH/c11-10(12,13)9(14)7-6-8-4-2-1-3-5-8;/h1-5,9H,6-7,14H2;1H

InChI key: InChIKey=VESQZHHAKUAZBP-UHFFFAOYSA-N

SMILES: C(CC(C(F)(F)F)N)C1=CC=CC=C1.Cl

Synonyms:

• Benzenepropanamine, α-(trifluoromethyl)-, hydrochloride (1:1)

1,1,1-Trifluoro-4-phenylbutan-2-amine hydrochloride

CAS: 1432681-60-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClF₃N

Purity: Min. 95%

Molecular weight: 239.66 g/mol

Ref: 3D-HHC68160