CAS 1432681-83-8

1-Bromo-1,1-difluoro-3-phenyl-2-propanone

Description:

1-Bromo-1,1-difluoro-3-phenyl-2-propanone is an organic compound characterized by its unique structure, which includes a bromine atom and two fluorine atoms attached to a propanone backbone, along with a phenyl group. This compound is typically classified as a halogenated ketone, and its molecular structure suggests it may exhibit significant reactivity due to the presence of the halogen substituents. The bromine and fluorine atoms can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. Additionally, the phenyl group contributes to the compound's aromatic characteristics, potentially affecting its chemical behavior and interactions. This compound may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as a building block in various chemical reactions. Safety and handling precautions are essential when working with halogenated compounds, as they can pose health and environmental risks.

Formula: C₉H₇BrF₂O

InChI: InChI=1S/C9H7BrF2O/c10-9(11,12)8(13)6-7-4-2-1-3-5-7/h1-5H,6H2

InChI key: InChIKey=NPXQURIDBHHQMW-UHFFFAOYSA-N

SMILES: C(C(C(Br)(F)F)=O)C1=CC=CC=C1

Synonyms:

• 2-Propanone, 1-bromo-1,1-difluoro-3-phenyl-
• 1-Bromo-1,1-difluoro-3-phenyl-2-propanone

1-Bromo-1,1-difluoro-3-phenylpropan-2-one

CAS: 1432681-83-8

Versatile small molecule scaffold

Formula: C₉H₇BrF₂O

Purity: Min. 95%

Molecular weight: 249.05 g/mol

Ref: 3D-HHC68183