CAS 1432754-65-8

3-Pyridinemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1)

Description:

3-Pyridinemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group and a methyl group at specific positions on the pyridine ring, contributing to its unique reactivity and properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and makes it suitable for various applications in pharmaceuticals and organic synthesis. The presence of the amino group indicates potential basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Its specific structural features may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential hazards associated with its use.

Formula: C₇H₉ClN₂·ClH

InChI: InChI=1S/C7H9ClN2.ClH/c1-5-2-6(3-9)7(8)10-4-5;/h2,4H,3,9H2,1H3;1H

InChI key: InChIKey=VVJNJHHVVRJOMK-UHFFFAOYSA-N

SMILES: C(N)C1=C(Cl)N=CC(C)=C1.Cl

Synonyms:

• 3-Pyridinemethanamine, 2-chloro-5-methyl-, hydrochloride (1:1)

(2-Chloro-5-methylpyridin-3-yl)methanamine hydrochloride

CAS: 1432754-65-8

(2-Chloro-5-methylpyridin-3-yl)methanamine hydrochloride

Purity: 95%

Molecular weight: 193.07g/mol

Ref: 54-OR1004528

(2-Chloro-5-methylpyridin-3-yl)methanamine hydrochloride

CAS: 1432754-65-8

Purity: 97+%

Molecular weight: 193.0700073

Ref: 10-F749744