CAS 143306-27-8

2-fluoro-6-nitrobenzonitrile

Description:

2-Fluoro-6-nitrobenzonitrile is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a cyano group attached to a benzene ring. The molecular structure features a benzene ring substituted at the 2-position with a fluorine atom and at the 6-position with a nitro group, while the cyano group is attached to the benzene ring, typically at the 1-position. This compound is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the nitro and cyano groups, which can participate in various chemical reactions. It is generally a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the electronegative fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks.

Formula: C₇H₃FN₂O₂

InChI: InChI=1/C7H3FN2O2/c8-6-2-1-3-7(10(11)12)5(6)4-9/h1-3H

SMILES: c1cc(c(C#N)c(c1)N(=O)=O)F

Synonyms:

• Benzonitrile, 2-Fluoro-6-Nitro-

2-Fluoro-6-nitrobenzonitrile

CAS: 143306-27-8

Formula: C₇H₃FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.1093

Ref: IN-DA006W6O

2-Fluoro-6-nitrobenzonitrile

CAS: 143306-27-8

2-Fluoro-6-nitrobenzonitrile

Purity: 98%

Color and Shape: Solid

Molecular weight: 166.11g/mol

Ref: 54-PC502596

2-Fluoro-6-nitrobenzonitrile

CAS: 143306-27-8

Formula: C₇H₃FN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 166.111

Ref: 10-F092336