
CAS 143323-55-1
:L 012
Description:
L 012, with the CAS number 143323-55-1, is a chemical compound known for its role as a luminescent probe in biochemical research. It is primarily utilized for detecting reactive oxygen species (ROS) and has applications in studying oxidative stress in biological systems. L 012 is characterized by its ability to emit light upon reaction with specific ROS, making it a valuable tool in fluorescence-based assays. The compound is often employed in cell culture studies and in vivo experiments to monitor oxidative damage and cellular responses to various stimuli. Its sensitivity and specificity to different types of ROS allow researchers to gain insights into cellular processes and disease mechanisms. Additionally, L 012 is typically used in conjunction with imaging techniques to visualize oxidative stress in real-time, contributing to a better understanding of its implications in various pathological conditions. As with any chemical, proper handling and safety precautions are essential when working with L 012 in laboratory settings.
Formula:C13H9ClN4O2
InChI:InChI=1S/C13H9ClN4O2/c14-11-8-7(12(19)17-18-13(8)20)9(15)10(16-11)6-4-2-1-3-5-6/h1-5H,15H2,(H,17,19)(H,18,20)
InChI key:InChIKey=ABEDICJFYSFCHB-UHFFFAOYSA-N
SMILES:NC1=C2C(=C(Cl)N=C1C3=CC=CC=C3)C(=O)NNC2=O
Synonyms:- 8-Amino-5-chloro-2,3-dihydro-7-phenylpyrido[3,4-d]pyridazine-1,4-dione
- Pyrido[3,4-d]pyridazine-1,4-dione, 8-amino-5-chloro-2,3-dihydro-7-phenyl-
- L 012
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L 012
CAS:L 012 is a bioactive chemical.Formula:C13H9ClN4O2Color and Shape:SolidMolecular weight:288.69
