CAS 143343-83-3
:Toborinone
Description:
Toborinone, identified by its CAS number 143343-83-3, is a chemical compound that belongs to the class of organic molecules known as ketones. It is characterized by the presence of a carbonyl group (C=O) within its molecular structure, which is typical of ketones. Toborinone is notable for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The compound may exhibit specific physical properties such as solubility in organic solvents and a distinct melting or boiling point, which are influenced by its molecular structure and functional groups. Additionally, its reactivity can be attributed to the carbonyl group, allowing it to participate in various chemical reactions, such as nucleophilic additions. While detailed information on its toxicity and environmental impact may be limited, like many organic compounds, it is essential to handle Toborinone with care, following appropriate safety protocols in laboratory settings. Overall, Toborinone represents a compound of interest for further research and application in chemical synthesis and development.
Formula:C21H24N2O5
InChI:InChI=1/C21H24N2O5/c1-26-19-7-3-14(9-20(19)27-2)11-22-12-16(24)13-28-17-5-6-18-15(10-17)4-8-21(25)23-18/h3-10,16,22,24H,11-13H2,1-2H3,(H,23,25)/t16-/m1/s1
InChI key:InChIKey=BYKYPZBCMBEEGU-UHFFFAOYSA-N
SMILES:O(CC(CNCC1=CC(OC)=C(OC)C=C1)O)C=2C=C3C(=CC2)NC(=O)C=C3
Synonyms:- (±)-6-[2-Hydroxy-3-(veratrylamino)propoxy]carbostyril
- OPC 18790
- 6-{3-[(3,4-dimethoxybenzyl)amino]-2-hydroxypropoxy}quinolin-2(1H)-one
- 6-({(2R)-3-[(3,4-dimethoxybenzyl)amino]-2-hydroxypropyl}oxy)quinolin-2(1H)-one
- CCRIS 7932
- Toborinone [INN]
- 2(1H)-Quinolinone, 6-[3-[[(3,4-dimethoxyphenyl)methyl]amino]-2-hydroxypropoxy]-
- (+-)-6-(2-Hydroxy-3-(veratrylamino)propoxy)carbostyril
- (+-)-6-(3-(((3,4-Dimethoxyphenyl)methyl)amino)-2-hydroxypropoxy)-2(1H)-quinolinone
- 2(1H)-Quinolinone, 6-(3-(((3,4-dimethoxyphenyl)methyl)amino)-2-hydroxypropoxy)-, (+-)-
- 6-[3-[[(3,4-Dimethoxyphenyl)methyl]amino]-2-hydroxypropoxy]-2(1H)-quinolinone
- 2(1H)-Quinolinone, 6-[3-[[(3,4-dimethoxyphenyl)methyl]amino]-2-hydroxypropoxy]-, (±)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Toborinone
CAS:Toborinone is a phosphodiesterase III inhibitor.Formula:C21H24N2O5Color and Shape:SolidMolecular weight:384.43
