CymitQuimica logo

CAS 143360-01-4

:

N-(4-Bromo-2-methoxyphenyl)acetamide

Description:
N-(4-Bromo-2-methoxyphenyl)acetamide is an organic compound characterized by its acetamide functional group attached to a substituted phenyl ring. The presence of a bromine atom at the para position and a methoxy group at the ortho position on the aromatic ring contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic aromatic structure, while the acetamide group can engage in hydrogen bonding, enhancing its solubility in polar solvents. It may display biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, which can be exploited in synthetic organic chemistry. Additionally, the compound's stability is influenced by the electronic effects of the bromine and methoxy substituents, which can affect reactivity and interaction with other molecules. Overall, N-(4-Bromo-2-methoxyphenyl)acetamide serves as a valuable compound in both synthetic and medicinal chemistry contexts.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-6(12)11-8-4-3-7(10)5-9(8)13-2/h3-5H,1-2H3,(H,11,12)
InChI key:InChIKey=OXHBMBUYHWMWKM-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(OC)C=C(Br)C=C1
Synonyms:
  • 2-Acetamido-5-bromoanisole
  • Acetamide, N-(4-bromo-2-methoxyphenyl)-
  • Chembrdg-Bb 7258803
  • N-(4-Bromo-2-methoxyphenyl)acetamide
Found 4 products.