CymitQuimica logo

CAS 143367-56-0

:

Stannane, [2,2'-bithiophene]-5,5'-diylbis[trimethyl-

Description:
Stannane, [2,2'-bithiophene]-5,5'-diylbis[trimethyl-] is an organotin compound characterized by the presence of a stannane functional group and a bithiophene moiety. This compound features a central tin atom bonded to two trimethyl groups and two bithiophene units, which are aromatic compounds containing sulfur atoms in their structure. The presence of the bithiophene structure imparts unique electronic properties, making it of interest in organic electronics and materials science. Organotin compounds like this one often exhibit interesting reactivity and can serve as precursors in the synthesis of various organometallic materials. Additionally, the trimethyl groups enhance the solubility of the compound in organic solvents, facilitating its use in various applications. However, it is important to note that organotin compounds can pose environmental and health risks, necessitating careful handling and disposal. Overall, this compound exemplifies the intersection of organometallic chemistry and organic synthesis, with potential applications in advanced materials and electronic devices.
Formula:C14H22S2Sn2
InChI:InChI=1S/C8H4S2.6CH3.2Sn/c1-3-7(9-5-1)8-4-2-6-10-8;;;;;;;;/h1-4H;6*1H3;;
InChI key:DOIRPCDOGSNNCS-UHFFFAOYSA-N
SMILES:C[Sn](C)(C)C1=CC=C(S1)C2=CC=C(S2)[Sn](C)(C)C
Synonyms:
  • 5,5-Ditrimethylstannyl-2,2'-Bithiophene
Found 6 products.