CAS 14337-53-2
:5-Br-PADAP
Description:
5-Br-PADAP, or 5-bromo-2-(4-aminophenyl)phenol, is a chemical compound characterized by its brominated aromatic structure. It features a bromine atom attached to a phenolic compound, which contributes to its reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the amino group enhances its solubility in polar solvents and allows for further chemical modifications. This compound is often utilized in research settings, particularly in studies related to dye chemistry and as a reagent in organic synthesis. Its properties may include moderate to high melting points, depending on the specific crystalline form, and it may exhibit moderate toxicity, necessitating careful handling in laboratory environments. Additionally, 5-Br-PADAP can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a versatile building block in synthetic organic chemistry. As with all chemical substances, proper safety protocols should be followed when working with 5-Br-PADAP to mitigate any potential hazards.
Formula:C15H17BrN4O
InChI:InChI=1S/C15H17BrN4O/c1-3-20(4-2)12-6-7-13(14(21)9-12)18-19-15-8-5-11(16)10-17-15/h5-10,21H,3-4H2,1-2H3
InChI key:InChIKey=HNVCXDAVEHOIBP-UHFFFAOYSA-N
SMILES:N(CC)(CC)C1=CC(O)=C(N=NC2=CC=C(Br)C=N2)C=C1
Synonyms:- 2-[2-(5-Bromo-2-pyridinyl)diazenyl]-5-(diethylamino)phenol
- 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
- Phenol, 2-[(5-bromo-2-pyridyl)azo]-5-(diethylamino)-
- Phenol, 2-[2-(5-bromo-2-pyridinyl)diazenyl]-5-(diethylamino)-
- Phenol, 2-[(5-bromo-2-pyridinyl)azo]-5-(diethylamino)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
CAS:Formula:C15H17BrN4OPurity:>98.0%(T)(HPLC)Color and Shape:Orange to Brown to Dark red powder to crystalMolecular weight:349.232-((5-Bromopyridin-2-yl)diazenyl)-5-(diethylamino)phenol
CAS:Formula:C15H17BrN4OPurity:98%Molecular weight:349.2322-(5-Bromo-2-pyridinylazo)-5-(diethylamino)phenol
CAS:Formula:C15H17BrN4OPurity:98%Color and Shape:SolidMolecular weight:349.22572-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
CAS:2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenolFormula:C15H17BrN4OPurity:98%Color and Shape: red solidMolecular weight:349.23g/mol2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol
CAS:2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol is a chemical that is used for the detection of hydrochloric acid in water vapor. It reacts with zirconium oxide, which generates a red fluorescing complex. The reaction can be detected by using a fluorescence spectrometer with a test sample. 2-(5-Bromo-2-pyridylazo)-5-(diethylamino)phenol is also used to detect the presence of nitrogen atoms and sodium citrate in samples by reacting with them. This chemical reacts with an acid complex to form stable complexes. The analytical method is based on measuring the redox potential of this reaction. The flow system of this technique allows for dehydration of dehydroascorbic acid (DHA).
Formula:C15H17BrN4OPurity:Min. 95%Color and Shape:PowderMolecular weight:349.23 g/mol





