CAS 14340-33-1
:1-Nitroso-4-phenylpiperazine
Description:
1-Nitroso-4-phenylpiperazine is a chemical compound characterized by its nitroso group (-NO) attached to a piperazine ring, which is further substituted with a phenyl group. This compound typically appears as a solid at room temperature and is known for its potential applications in medicinal chemistry and as an intermediate in organic synthesis. The presence of the nitroso group can impart unique reactivity, making it useful in various chemical reactions, including those involving nucleophiles. Its molecular structure contributes to its properties, such as solubility in organic solvents and potential interactions with biological systems. Safety considerations are important, as nitroso compounds can exhibit toxicity and carcinogenicity under certain conditions. Therefore, handling 1-nitroso-4-phenylpiperazine requires appropriate safety measures, including the use of personal protective equipment and adherence to regulatory guidelines. Overall, this compound serves as an interesting subject for research in both synthetic and medicinal chemistry contexts.
Formula:C10H13N3O
InChI:InChI=1S/C10H13N3O/c14-11-13-8-6-12(7-9-13)10-4-2-1-3-5-10/h1-5H,6-9H2
InChI key:InChIKey=FISCVUKZOKHQGD-UHFFFAOYSA-N
SMILES:N(=O)N1CCN(CC1)C2=CC=CC=C2
Synonyms:- 1-Nitroso-4-Phenylpiperazine
- Piperazine, 1-nitroso-4-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-Nitroso-4-phenylpiperazine
CAS:Controlled ProductApplications Metabolite of N-Phenylpiperazine (P336040) found in wastewater treatment facilities.
References Jung, C. et al., Appl. Environ. Microb., 74, 6147 (2008)Formula:C10H13N3OColor and Shape:NeatMolecular weight:191.23


