CAS 1434128-45-6
:Methyl 4-bromo-2-(4-methyl-1-piperazinyl)benzoate
Description:
Methyl 4-bromo-2-(4-methyl-1-piperazinyl)benzoate is a chemical compound characterized by its complex structure, which includes a benzoate moiety substituted with a bromine atom and a piperazine ring. This compound features a methyl group attached to the piperazine, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the bromine atom introduces a halogen, which can affect the compound's reactivity and interaction with biological targets. Methyl 4-bromo-2-(4-methyl-1-piperazinyl)benzoate is likely to exhibit properties typical of both aromatic compounds and piperazine derivatives, such as potential pharmacological activity. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it of interest in medicinal chemistry and drug development. Overall, this compound's unique characteristics may contribute to its utility in various applications, particularly in the field of pharmaceuticals.
Formula:C13H17BrN2O2
InChI:InChI=1S/C13H17BrN2O2/c1-15-5-7-16(8-6-15)12-9-10(14)3-4-11(12)13(17)18-2/h3-4,9H,5-8H2,1-2H3
InChI key:InChIKey=GZPDRAKFFASADU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=C(Br)C=C1)N2CCN(C)CC2
Synonyms:- Benzoic acid, 4-bromo-2-(4-methyl-1-piperazinyl)-, methyl ester
- Methyl 4-bromo-2-(4-methyl-1-piperazinyl)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 4-Bromo-2-(4-methyl-1-piperazinyl)benzoate
CAS:Methyl 4-Bromo-2-(4-methyl-1-piperazinyl)benzoate
Molecular weight:313.19g/mol
