CAS 1434128-58-1

4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-, hydrochloride (1:1)

Description:

4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-, hydrochloride (1:1) is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a thiazole ring. This compound typically exhibits properties associated with both nitrogen and sulfur-containing heterocycles, such as potential biological activity and reactivity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, which often enhances solubility in water and may influence its pharmacological properties. The presence of the dihydro designation suggests that the compound has two hydrogen atoms added to the double bonds in the thiazole ring, which can affect its stability and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could contribute to various biological activities, including antimicrobial or anticancer properties. As with many heterocycles, its synthesis and characterization would involve standard organic chemistry techniques, and it may serve as a building block for further chemical modifications or applications in drug development.

Formula: C₅H₆N₂S·ClH

InChI: InChI=1S/C5H6N2S.ClH/c1-4-5(2-6-1)8-3-7-4;/h3,6H,1-2H2;1H

InChI key: InChIKey=ZIRXFVNXZQANKQ-UHFFFAOYSA-N

SMILES: C12=C(SC=N1)CNC2.Cl

Synonyms:

• 4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-, hydrochloride (1:1)

5,6-Dihydro-4H-pyrrolo[3,4-d]thiazole Hydrochloride

CAS: 1434128-58-1

Formula: C₅H₇ClN₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 162.6405

Ref: IN-DA00HWW3

5,6-Dihydro-4H-pyrrolo[3,4-d]thiazole hydrochloride

CAS: 1434128-58-1

5,6-Dihydro-4H-pyrrolo[3,4-d]thiazole hydrochloride

Purity: ≥95%

Molecular weight: 162.64g/mol

Ref: 54-OR470645

5,6-Dihydro-4H-pyrrolo[3,4-d]thiazole hydrochloride

CAS: 1434128-58-1

Purity: 98%

Molecular weight: 162.6399994

Ref: 10-F611701