CymitQuimica logo

CAS 1434141-67-9

:

2-Azaspiro[3.5]nonan-7-ol

Description:
2-Azaspiro[3.5]nonan-7-ol is a bicyclic organic compound characterized by its unique spiro structure, which consists of a nitrogen atom incorporated into a bicyclic framework. This compound features a hydroxyl (-OH) group at the 7-position, contributing to its potential as an alcohol. The presence of the nitrogen atom in the spiro system suggests that it may exhibit interesting chemical reactivity and biological activity, making it a subject of interest in medicinal chemistry and drug development. The spirocyclic nature of the molecule can influence its conformational flexibility and steric interactions, which are critical for its interactions with biological targets. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present and the overall molecular geometry. While specific applications or biological activities may vary, compounds of this type are often explored for their potential in pharmaceuticals, agrochemicals, and materials science due to their unique structural properties.
Formula:C8H15NO
InChI:InChI=1S/C8H15NO/c10-7-1-3-8(4-2-7)5-9-6-8/h7,9-10H,1-6H2
InChI key:InChIKey=CARZJFHAFKTUQP-UHFFFAOYSA-N
SMILES:OC1CCC2(CC1)CNC2
Synonyms:
  • 2-Azaspiro[3.5]nonan-7-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.