CAS 1434142-15-0

1,1-Dimethylethyl 6-(hydroxymethyl)-1-azaspiro[3.3]heptane-1-carboxylate

Description:

1,1-Dimethylethyl 6-(hydroxymethyl)-1-azaspiro[3.3]heptane-1-carboxylate, identified by its CAS number 1434142-15-0, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom within a bicyclic framework. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the hydroxymethyl group suggests that it may participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility in polar solvents. The tert-butyl group (1,1-dimethylethyl) enhances the steric bulk around the nitrogen, which may affect its biological activity and interactions with other molecules. Such structural features often indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review. Overall, this compound exemplifies the complexity and diversity of organic molecules in chemical research.

Formula: C₁₂H₂₁NO₃

InChI: InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-5-4-12(13)6-9(7-12)8-14/h9,14H,4-8H2,1-3H3

InChI key: InChIKey=ZLBQIHWNUIWRJM-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2(CC(CO)C2)CC1

Synonyms:

• 1-Azaspiro[3.3]heptane-1-carboxylic acid, 6-(hydroxymethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 6-(hydroxymethyl)-1-azaspiro[3.3]heptane-1-carboxylate

tert-Butyl 6-(hydroxymethyl)-1-azaspiro[3.3]heptane-1-carboxylate

CAS: 1434142-15-0

Versatile small molecule scaffold

Formula: C₁₂H₂₁NO₃

Purity: Min. 95%

Molecular weight: 227.3 g/mol

Ref: 3D-JHC14215