CAS 143426-49-7
:[4-(1H-pyrazol-1-yl)phenyl]methanol
Description:
[4-(1H-pyrazol-1-yl)phenyl]methanol, with the CAS number 143426-49-7, is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a methylene bridge that connects to a 4-substituted phenyl group, which in turn is substituted with a pyrazole moiety. This compound exhibits properties typical of both phenolic and pyrazole derivatives, including potential hydrogen bonding capabilities due to the hydroxyl group and the nitrogen atoms in the pyrazole ring. It may display biological activity, making it of interest in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the hydroxyl group, while its aromatic structure may contribute to its stability and reactivity in various chemical environments. Additionally, the presence of the pyrazole ring can impart unique electronic properties, influencing its interaction with other molecules. Overall, [4-(1H-pyrazol-1-yl)phenyl]methanol is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C10H10N2O
InChI:InChI=1/C10H10N2O/c13-8-9-2-4-10(5-3-9)12-7-1-6-11-12/h1-7,13H,8H2
SMILES:c1cnn(c1)c1ccc(cc1)CO
Synonyms:- 1-(4-Hydroxymethyl-phenyl) pyrazole
- (4-Pyrazol-1-Yl-Phenyl)Methanol
- 4-(1-Pyrazolyl)Benzylalcohol
- Buttpark 98\50-44
- Rarechem Al Bd 1319
- 4-Pyrazol-1-ylbenzyl alcohol
- 4-(1H-Pyrazol-1-yl)benzyl alcohol
- 4-(1H-pyrazol-1-yl)-benzenemethanol
- (4-Pyrazol-1-Ylphenyl)Methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(4-Pyrazol-1-yl-phenyl)methanol
CAS:Formula:C10H10N2OPurity:98%Color and Shape:SolidMolecular weight:174.1992[4-(1H-Pyrazol-1-yl)phenyl]methanol
CAS:[4-(1H-Pyrazol-1-yl)phenyl]methanolPurity:≥95%Color and Shape:Off-White SolidMolecular weight:174.20g/mol[4-(1H-Pyrazol-1-yl)phenyl]methanol
CAS:Formula:C10H10N2OPurity:98%Color and Shape:SolidMolecular weight:174.203(4-Pyrazol-1-yl-phenyl)methanol
CAS:<p>Versatile small molecule scaffold</p>Formula:C10H10N2OPurity:Min. 95%Molecular weight:174.2 g/mol(4-Pyrazol-1-yl-phenyl)methanol
CAS:(4-Pyrazol-1-yl-phenyl)methanol is a useful organic compound for research related to life sciences. The catalog number is T65752 and the CAS number is 143426-49-7.Formula:C10H10N2OColor and Shape:SolidMolecular weight:174.203




