CAS 143426-52-2

1-[4-(CHLOROMETHYL)PHENYL]-1H-PYRAZOLE HYDROCHLORIDE

Description:

1-[4-(Chloromethyl)phenyl]-1H-pyrazole hydrochloride is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a chloromethyl group attached to a phenyl ring enhances its reactivity and potential for various chemical transformations. This compound typically appears as a white to off-white solid and is soluble in polar solvents, which is common for many hydrochloride salts. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The hydrochloride form indicates that the compound is a salt, which can influence its stability, solubility, and bioavailability. Safety data should be consulted for handling and storage, as the chloromethyl group can be reactive and potentially hazardous. Overall, this compound's unique structure and functional groups contribute to its potential applications in medicinal chemistry and other fields.

Formula: C₁₀H₉ClN₂

InChI: InChI=1/C10H9ClN2/c11-8-9-2-4-10(5-3-9)13-7-1-6-12-13/h1-7H,8H2

SMILES: c1cnn(c1)c1ccc(cc1)CCl

Synonyms:

• 1-[4-(chloromethyl)phenyl]-1H-pyrazole

1-(4-(Chloromethyl)phenyl)-1H-pyrazole

CAS: 143426-52-2

Formula: C₁₀H₉ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 192.6449

Ref: IN-DA003DTG

1-[4-(Chloromethyl)phenyl]-1H-pyrazole

CAS: 143426-52-2

1-[4-(Chloromethyl)phenyl]-1H-pyrazole

Purity: 97%

Color and Shape: Solid

Molecular weight: 192.64g/mol

Ref: 54-OR59436

1-[4-(chloromethyl)phenyl]-1H-pyrazole

CAS: 143426-52-2

Formula: C₁₀H₉ClN₂

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 192.65

Ref: 10-F309526