CAS 14344-48-0
:L,L-Ethylenedicysteine
Description:
L,L-Ethylenedicysteine, with the CAS number 14344-48-0, is a chemical compound characterized by its structure, which features two cysteine units linked by an ethylene bridge. This compound is a derivative of cysteine, an amino acid known for its thiol (-SH) groups, which contribute to its reactivity and ability to form disulfide bonds. L,L-Ethylenedicysteine exhibits properties typical of thiol-containing compounds, including the potential for redox reactions and the ability to chelate metal ions. It is soluble in water and polar solvents, making it useful in various biochemical applications. The compound may also play a role in biological systems, particularly in protein synthesis and stabilization due to its ability to form disulfide linkages. Additionally, L,L-Ethylenedicysteine has been studied for its potential antioxidant properties, which could have implications in therapeutic contexts. Overall, its unique structure and functional groups make it a compound of interest in both research and industrial applications.
Formula:C8H16N2O4S2
InChI:InChI=1S/C8H16N2O4S2/c11-7(12)5(3-15)9-1-2-10-6(4-16)8(13)14/h5-6,9-10,15-16H,1-4H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1
InChI key:InChIKey=BQHFYSWNHZMMDO-WDSKDSINSA-N
SMILES:[C@@H](NCCN[C@H](C(O)=O)CS)(C(O)=O)CS
Synonyms:- L,L-Ethylenedicysteine
- L-Cysteine, N,N′-1,2-ethanediylbis-
- Cysteine, N,N′-ethylenedi-
- N,N′-1,2-Ethanediylbis[L-cysteine]
- Cysteine, N,N′-ethylenedi-, L-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethylenedicysteine
CAS:Ethylenedicysteine is a metabolite of ethylene cysteine dimer (ECD).Formula:C8H16N2O4S2Color and Shape:SolidMolecular weight:268.35

