CAS 143457-40-3

N-{2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl}-3-naphthalen-2-yl-L-alanyl-L-alaninamide

Description:

N-{2-[2-(hydroxyamino)-2-oxoethyl]-4-methylpentanoyl}-3-naphthalen-2-yl-L-alanyl-L-alaninamide, with CAS number 143457-40-3, is a synthetic compound that belongs to a class of molecules known for their potential biological activity. This substance features a complex structure characterized by the presence of a naphthalene moiety, which is known for its aromatic properties, and an amino acid derivative, indicating potential interactions with biological systems. The hydroxyamino and oxoethyl groups suggest that it may participate in hydrogen bonding and other intermolecular interactions, which could influence its solubility and reactivity. The presence of multiple chiral centers implies that the compound may exhibit stereoisomerism, potentially affecting its pharmacological properties. Such compounds are often investigated for their roles in medicinal chemistry, particularly in the development of therapeutic agents. Overall, the unique structural features of this compound may contribute to its functionality in various biochemical pathways, making it a subject of interest in research and development.

Formula: C₂₄H₃₂N₄O₅

InChI: InChI=1/C24H32N4O5/c1-14(2)10-19(13-21(29)28-33)23(31)27-20(24(32)26-15(3)22(25)30)12-16-8-9-17-6-4-5-7-18(17)11-16/h4-9,11,14-15,19-20,33H,10,12-13H2,1-3H3,(H2,25,30)(H,26,32)(H,27,31)(H,28,29)/t15-,19?,20-/m0/s1

SMILES: CC(C)CC(CC(=NO)O)C(=N[C@@H](Cc1ccc2ccccc2c1)C(=N[C@@H](C)C(=N)O)O)O

TAPI-0

CAS: 143457-40-3

A hydroxamate-based inhibitor of collagenase, gelatinase, and TACE. TACE stands for Tumor Necrosis Factor-α Converting Enzyme. It is also known as ADAM17 (A Disintegrin and Metalloproteinase 17)

Formula: C₂₄H₃₂N₄O₅

Purity: Min. 95%

Molecular weight: 456.54 g/mol

Ref: 3D-INH-3850-PI

TAPI-0

CAS: 143457-40-3

TAPI-0 is a matrix metalloprotease (MMP) and TACE inhibitor.

Formula: C₂₄H₃₂N₄O₅

Color and Shape: Solid

Molecular weight: 456.53

Ref: TM-T70664