CymitQuimica logo

CAS 143469-23-2

:

3-Chloro-2-(trifluoromethyl)thiophene

Description:
3-Chloro-2-(trifluoromethyl)thiophene is a heterocyclic organic compound characterized by a thiophene ring, which is a five-membered aromatic ring containing sulfur. The presence of a chlorine atom at the 3-position and a trifluoromethyl group at the 2-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It exhibits a range of chemical behaviors, including potential electrophilic substitution reactions due to the electron-withdrawing nature of the trifluoromethyl group, which can enhance the reactivity of the thiophene ring. Additionally, the chlorine substituent can participate in nucleophilic substitution reactions. 3-Chloro-2-(trifluoromethyl)thiophene is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in the synthesis of more complex molecules. Its unique structure and functional groups make it a valuable compound for further chemical research and development.
Formula:C5H2ClF3S
InChI:InChI=1S/C5H2ClF3S/c6-3-1-2-10-4(3)5(7,8)9/h1-2H
InChI key:InChIKey=RKERFDGHTJHRNL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C=CS1
Synonyms:
  • 3-Chloro-2-(trifluoromethyl)thiophene
  • Thiophene, 3-chloro-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.