CAS 14348-41-5: 3-Bromo-4-hydroxybenzoic acid
Description:3-Bromo-4-hydroxybenzoic acid, with the CAS number 14348-41-5, is an aromatic compound that features a bromine atom and a hydroxyl group attached to a benzoic acid structure. This compound is characterized by its molecular formula, which includes carbon, hydrogen, bromine, and oxygen atoms. It typically appears as a solid, often in crystalline form, and is soluble in organic solvents while exhibiting limited solubility in water. The presence of the bromine substituent can influence its reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The hydroxyl group contributes to its acidity and potential for hydrogen bonding, affecting its interactions in biological systems. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and analysis. Overall, 3-Bromo-4-hydroxybenzoic acid is a valuable compound in organic chemistry with diverse applications.
Formula:C7H5BrO3
InChI:InChI=1S/C7H5BrO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11)
InChI key:InChIKey=XMEQDAIDOBVHEK-UHFFFAOYSA-N
SMILES:O=C(O)C1=CC=C(O)C(Br)=C1
- Synonyms:
- 3-Bromo-4-Hydroxybenzoate
- 3-Bromo-4-Hydroxybenzoic Acid Hydrate
- Benzoic acid, 3-bromo-4-hydroxy-
- m-Bromo-p-hydroxybenzoic acid
- 3-Bromo-4-hydroxybenzoic acid
