CAS 143487-47-2: Cyclopentyltrimethoxysilane
Description:Cyclopentyltrimethoxysilane, with the CAS number 143487-47-2, is an organosilicon compound characterized by its silane functional group, which includes a cyclopentyl group and three methoxy groups. This compound typically appears as a clear, colorless liquid and is known for its ability to bond with various substrates, making it useful as a coupling agent or surface modifier in various applications, including coatings, adhesives, and sealants. Its structure allows for good compatibility with organic materials while providing silane functionality that enhances adhesion and durability. Cyclopentyltrimethoxysilane is also valued for its potential to improve the hydrophobicity and chemical resistance of treated surfaces. Additionally, it can undergo hydrolysis, leading to the formation of silanol groups that can further polymerize or bond with other materials. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, its unique properties make it a versatile compound in the field of materials science and engineering.
Formula:C8H18O3Si
InChI:InChI=1S/C8H18O3Si/c1-9-12(10-2,11-3)8-6-4-5-7-8/h8H,4-7H2,1-3H3
InChI key:InChIKey=YRMPTIHEUZLTDO-UHFFFAOYSA-N
SMILES:O(C)[Si](OC)(OC)C1CCCC1
- Synonyms:
- Silane, cyclopentyltrimethoxy-
- Cyclopentyltrimethoxysilane
- Cyclopentane, (trimethoxysilyl)-
- (Trimethoxysilyl)cyclopentane

Cyclopentyltrimethoxysilane, 95%
Ref: 02-L16442
25g | To inquire | ||
100g | 360.00 € |

Cyclopentyltrimethoxysilane
Ref: IN-DA003P6O
1g | 26.00 € | ||
5g | 39.00 € | ||
10g | 59.00 € | ||
25g | 104.00 € | ||
100g | 236.00 € |

Ref: 54-OR1012745
1g | 32.00 € | ||
5g | 36.00 € | ||
25g | 82.00 € | ||
100g | 275.00 € | ||
500g | 1,219.00 € |

Cyclopentyltrimethoxysilane
Ref: 3B-C3589
5g | 33.00 € | ||
25g | 90.00 € |

Cyclopentyltrimethoxysilane
Ref: 10-S05375
10g | 63.00 € | ||
100g | 267.00 € |

CYCLOPENTYLTRIMETHOXYSILANE
Ref: 3H-SIC2557.0
10g | Discontinued | Request information | |
2kg | Discontinued | Request information | |
50g | Discontinued | Request information |

Cyclopentyltrimethoxysilane
Ref: 3D-TFA48747
250g | Discontinued | Request information |