CAS 143492-38-0
:D-ERYTHRO-MAPP
Description:
D-Erythro-MAPP, with the CAS number 143492-38-0, is a chemical compound that belongs to the class of phosphonates. It is characterized by its specific stereochemistry, which is crucial for its biological activity. The "D" prefix indicates the configuration of the molecule, which can influence its interaction with biological systems. D-Erythro-MAPP is often studied for its potential applications in agriculture, particularly as a plant growth regulator, due to its ability to modulate metabolic pathways in plants. The compound is typically soluble in polar solvents, which facilitates its application in various formulations. Its stability under standard conditions makes it suitable for use in various environments. Additionally, like many phosphonates, it may exhibit low toxicity to non-target organisms, making it a candidate for environmentally friendly agricultural practices. However, as with any chemical substance, proper handling and safety measures should be observed to mitigate any potential risks associated with its use.
Formula:C23H39NO2
InChI:InChI=1/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-16-19-22(25)24-20(2)23(26)21-17-14-13-15-18-21/h13-15,17-18,20,23,26H,3-12,16,19H2,1-2H3,(H,24,25)/t20-,23-/m1/s1
SMILES:CCCCCCCCCCCCCC(=N[C@H](C)[C@H](c1ccccc1)O)O
Synonyms:- Mapp, D-Erythro
- (1S,2R)-D-Erythro-2-(N-Myristoylamino)-1-Phenyl-1-Propanol
- N-[(1R,2S)-2-Hydroxy-1-Methyl-2-Phenylethyl]-Tetradecanamide
- N-[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]tetradecanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-[(1R,2S)-2-Hydroxy-1-methyl-2-phenylethyl]-tetradecanamide
CAS:Controlled ProductApplications N-[(1R,2S)-2-Hydroxy-1-methyl-2-phenylethyl]-tetradecanamide is a ceramide analog. It is an inhibitor of ceramidase.
References Bielawska, A., et al.: J. Biol. Chem., 271, 12646 (1996); Rodriguez-Lafrasse, C., et al.: Int. J. Cancer, 101, 589 (2002)Formula:C23H39NO2Color and Shape:NeatMolecular weight:361.561D-erythro-MAPP
CAS:D-erythro-MAPP (D-e-MAPP) is a ceramidase inhibitor, a ceramide analog with potential anticancer activity.
Formula:C23H39NO2Color and Shape:SolidMolecular weight:361.56

