CAS 143508-76-3

3,7,8,9-Tetrahydro-3-methylpyrano[3,2-e]indole-1-ethanamine

Description:

3,7,8,9-Tetrahydro-3-methylpyrano[3,2-e]indole-1-ethanamine is a complex organic compound characterized by its unique bicyclic structure, which includes a pyranoindole framework. This compound features a tetrahydroindole moiety, indicating that it contains a saturated nitrogen-containing ring, contributing to its potential biological activity. The presence of a methyl group and an ethanamine side chain suggests that it may exhibit amine-like properties, which can influence its solubility and reactivity. The compound's structure may allow for interactions with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, the specific arrangement of functional groups can affect its pharmacokinetics and pharmacodynamics, potentially leading to various therapeutic applications. However, detailed studies on its biological effects, toxicity, and synthesis are necessary to fully understand its characteristics and potential uses. As with many organic compounds, its stability and reactivity can be influenced by environmental conditions such as pH, temperature, and the presence of other chemicals.

Formula: C₁₄H₁₈N₂O

InChI: InChI=1S/C14H18N2O/c1-16-9-10(6-7-15)14-11-3-2-8-17-13(11)5-4-12(14)16/h4-5,9H,2-3,6-8,15H2,1H3

InChI key: InChIKey=CCGPJPFGXFZHAJ-UHFFFAOYSA-N

SMILES: C(CN)C=1C=2C3=C(C=CC2N(C)C1)OCCC3

Synonyms:

• Pyrano[3,2-e]indole-1-ethanamine, 3,7,8,9-tetrahydro-3-methyl-
• 3,7,8,9-Tetrahydro-3-methylpyrano[3,2-e]indole-1-ethanamine

CP 132484

CAS: 143508-76-3

CP 132484: potent, selective 5-HT₂ agonist; favors 5-HT2A, 5-HT2C over 5-HT2B. Limited 5-HT2A over 5-HT2C selectivity.

Formula: C₁₄H₁₈N₂O

Color and Shape: Solid

Molecular weight: 230.31

Ref: TM-T70656