CAS 14351-29-2
:Dammarenediol
Description:
Dammarenediol is a triterpenoid compound characterized by its complex structure, which includes multiple rings and functional groups. It is derived from the dammar resin, commonly found in various plant species, particularly in the family Dipterocarpaceae. The compound exhibits a white to pale yellow crystalline appearance and is known for its hydrophobic nature, making it insoluble in water but soluble in organic solvents. Dammarenediol has garnered interest in the fields of natural products and medicinal chemistry due to its potential biological activities, including anti-inflammatory and antimicrobial properties. Its structure features a tetracyclic framework, which is typical of many triterpenoids, contributing to its stability and reactivity. Additionally, dammarenediol can serve as a precursor for the synthesis of other bioactive compounds, enhancing its significance in pharmaceutical research. Overall, the unique characteristics of dammarenediol make it a valuable subject of study in both natural product chemistry and potential therapeutic applications.
Formula:C30H52O2
InChI:InChI=1S/C30H52O2/c1-20(2)10-9-16-30(8,32)22-13-18-28(6)21(22)11-12-24-27(5)17-15-25(31)26(3,4)23(27)14-19-29(24,28)7/h10,21-25,31-32H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,27+,28-,29-,30+/m1/s1
InChI key:InChIKey=NLHQJXWYMZLQJY-TXNIMPHESA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O)CC3)[H])(CC[C@]4([C@@]2(C)CC[C@@]4([C@@](CCC=C(C)C)(C)O)[H])[H])[H]
Synonyms:- (20S)-Dammar-24-ene-3β,20-diol
- (3Beta,13Xi,17Xi)-Dammar-24-Ene-3,20-Diol
- (3β)-Dammar-24-ene-3,20-diol
- 20S-Dammarenediol
- 20S-Dammarenediol II
- 3beta-Dammar-24-ene-3,20-diol
- Dammar-24-ene-3,20-diol, (3beta)-
- Dammar-24-ene-3,20-diol, (3β)-
- Dammar-24-ene-3beta,20-diol
- Dammar-24-ene-3β,20-diol, (20S)-
- Dammarenediol II
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Dammarenediol II
CAS:Controlled ProductDammarenediol II is a bioactive compound, which is a triterpenoid. It is derived from natural sources like medicinal plants, particularly found in ginseng roots. This compound acts as an intermediate in the biosynthesis of saponins, which are known for their considerable biological activities. The mode of action of Dammarenediol II primarily involves its role as a precursor in the synthesis pathways of ginsenosides, which are the active constituents responsible for the pharmacological effects of ginseng.Formula:C30H52O2Purity:Min. 95%Molecular weight:444.73 g/mol


