CAS 14353-86-7
:Tris(2,2,2-trifluoroacetato-κO)iodine
Description:
Tris(2,2,2-trifluoroacetato-κO)iodine, with the CAS number 14353-86-7, is a coordination compound featuring iodine as the central metal atom coordinated to three 2,2,2-trifluoroacetate ligands. This compound is characterized by its strong electronegative trifluoroacetate groups, which impart significant polarity and influence its solubility in polar solvents. The presence of fluorine atoms enhances the compound's stability and reactivity, making it useful in various chemical applications, including organic synthesis and catalysis. The iodine center typically exhibits oxidation states that can vary depending on the coordination environment, influencing the compound's reactivity and potential applications in fields such as medicinal chemistry and materials science. Additionally, the compound's unique properties may be leveraged in the development of fluorinated materials or as a reagent in organic transformations. Overall, Tris(2,2,2-trifluoroacetato-κO)iodine is notable for its distinctive structural and electronic characteristics, which arise from the interplay between the iodine atom and the highly electronegative trifluoroacetate ligands.
Formula:C6F9IO6
InChI:InChI=1S/C6F9IO6/c7-4(8,9)1(17)20-16(21-2(18)5(10,11)12)22-3(19)6(13,14)15
InChI key:InChIKey=LLKSJVKRWAPXNE-UHFFFAOYSA-N
SMILES:I(OC(C(F)(F)F)=O)(OC(C(F)(F)F)=O)OC(C(F)(F)F)=O
Synonyms:- Acetic acid, trifluoro-, iodine complex
- Acetic acid, trifluoro-, trianhydride with iodous acid (H<sub>3</sub>IO<sub>3</sub>)
- Iodine tris(trifluoroacetate)
- Iodine, tris(2,2,2-trifluoroacetato-κO)-
- Iodine, tris(trifluoroacetato-O)-
- Iodine, tris(trifluoroacetato-κO)-
- Iodosotris(trifluoroacetate)
- Iodotris(trifluoroacetate)
- Iodous acid (H<sub>3</sub>IO<sub>3</sub>), trianhydride with trifluoroacetic acid
- Tris(2,2,2-trifluoroacetato-κO)iodine
- Tris(trifluoroacetoxy)iodine
- Tris[(Trifluoroacetyl)Oxy]-Lambda~3~-Iodane
- Iodous acid (H3IO3), trianhydride with trifluoroacetic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tris(trifluoroacetoxy)iodine
CAS:Controlled ProductFormula:C6F9IO6Color and Shape:NeatMolecular weight:465.951Tris(trifluoroacetoxy)iodine
CAS:<p>Tris(trifluoroacetoxy)iodine is an analog of iodine that has shown promise as an anticancer agent. It works by inhibiting kinase activity, which can disrupt the cell cycle and lead to apoptosis in cancer cells. Tris(trifluoroacetoxy)iodine has been found to be effective against a variety of human cancer cell lines, including those resistant to other anticancer agents. In addition, it has been shown to inhibit elastase activity and may have potential as an inhibitor of protein degradation in cancer cells. Overall, Tris(trifluoroacetoxy)iodine holds great potential as a new class of anticancer inhibitors with promising results for tumor treatment.</p>Formula:C6F9IO6Purity:Min. 95%Molecular weight:465.95 g/mol

