CAS 143536-99-6
:4-METHOXYPHENYL 2,3,4,6-TETRA-O-BENZYL-BETA-D-GALACTOPYRANOSIDE
Description:
4-Methoxyphenyl 2,3,4,6-tetra-O-benzyl-β-D-galactopyranoside is a complex glycoside characterized by its structural components, which include a galactopyranoside backbone and multiple benzyl groups. The presence of the methoxyphenyl group enhances its solubility and reactivity, making it useful in various chemical applications. This compound is typically white to off-white in appearance and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water due to its hydrophobic benzyl groups. It is often utilized in synthetic organic chemistry, particularly in the synthesis of glycosides and as a building block in the preparation of more complex molecules. The compound's stability and reactivity can be influenced by the presence of the benzyl protecting groups, which can be selectively removed under specific conditions. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation.
Formula:C41H42O7
InChI:InChI=1/C41H42O7/c1-42-35-22-24-36(25-23-35)47-41-40(46-29-34-20-12-5-13-21-34)39(45-28-33-18-10-4-11-19-33)38(44-27-32-16-8-3-9-17-32)37(48-41)30-43-26-31-14-6-2-7-15-31/h2-25,37-41H,26-30H2,1H3/t37-,38+,39+,40-,41-/m1/s1
Synonyms:- 4-Methoxyphenyl2,3,4,6-tetra-O-benzyl-b-D-galactopyranoside
- 4-methoxyphenyl 2,3,4,6-tetra-O-benzyl-β-D-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(2R,3S,4S,5R,6S)-3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)-6-(4-methoxyphenoxy)tetrahydro-2H-pyran
CAS:Formula:C41H42O7Purity:98%Color and Shape:SolidMolecular weight:646.76804-Methoxyphenyl 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranosidePurity:>98.0%4-Methoxyphenyl 2,3,4,6-Tetra-O-benzyl-β-D-galactopyranoside
CAS:Formula:C41H42O7Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:646.784-Methoxyphenyl 2,3,4,6-tetra-O-benzyl-β-D-galactopyranoside
CAS:<p>4-Methoxyphenyl 2,3,4,6-tetra-O-benzyl-b-D-galactopyranoside is a matrix assisted laser desorption/ionization (MALDI) probe that is used for the detection of esophageal cancer. This probe has been shown to be resistant to non-Hodgkin's lymphoma and dna–dna hybridization. The type strain of this agent was found in a clinical sample from an esophagus biopsy. 4MPBGP has also been shown to have coagulation and waveform properties.</p>Formula:C41H42O7Purity:Min. 95%Molecular weight:646.77 g/mol




