CymitQuimica logo

CAS 143557-91-9

:

tert-butyl 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate

Description:
Tert-butyl 3-hydroxy-8-azabicyclo[3.2.1]octane-8-carboxylate, identified by its CAS number 143557-91-9, is a bicyclic compound featuring a nitrogen atom within its structure, characteristic of azabicyclic compounds. This substance typically exhibits a complex molecular architecture, which contributes to its unique chemical properties. The presence of the tert-butyl group enhances its lipophilicity, potentially influencing its solubility and reactivity in organic solvents. The hydroxyl group at the 3-position may impart hydrogen-bonding capabilities, affecting its interactions with other molecules. Additionally, the carboxylate moiety at the 8-position suggests potential for ionic interactions, which could be relevant in biological systems or in the formation of salts. Overall, the combination of these functional groups and structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its reactivity, stability, and potential applications.
Formula:C12H21NO3
InChI:InChI=1/C12H21NO3/c1-12(2,3)16-11(15)13-8-4-5-9(13)7-10(14)6-8/h8-10,14H,4-7H2,1-3H3
InChI key:SEGZJJSZYOEABC-ULKQDVFKSA-N
SMILES:CC(C)(C)OC(=O)N1C2CCC1CC(C2)O
Found 4 products.