CymitQuimica logo

CAS 143564-89-0

:

(2R,4R)-3-Benzyloxycarbonyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one

Description:
(2R,4R)-3-Benzyloxycarbonyl-4-methyl-2-phenyl-1,3-oxazolidin-5-one is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound is notable for its stereochemistry, specifically the (2R,4R) configuration, which influences its biological activity and interactions. The presence of the benzyloxycarbonyl group enhances its stability and solubility, making it suitable for various applications in organic synthesis and medicinal chemistry. The methyl and phenyl substituents contribute to its lipophilicity, potentially affecting its pharmacokinetic properties. As a derivative of oxazolidinone, it may exhibit antimicrobial or anti-inflammatory properties, which are common in compounds of this class. The CAS number 143564-89-0 uniquely identifies this substance in chemical databases, facilitating its study and application in research and industry. Overall, this compound represents a valuable scaffold in drug development and synthetic chemistry due to its unique structural features and potential biological activities.
Formula:C18H17NO4
InChI:InChI=1/C18H17NO4/c1-13-17(20)23-16(15-10-6-3-7-11-15)19(13)18(21)22-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-,16-/m1/s1
InChI key:USPAXEIEXNCGOJ-CZUORRHYSA-N
SMILES:C[C@@H]1C(=O)O[C@@H](N1C(=O)OCC2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • (2R,4R)-4-Methyl-5-oxo-2-phenyl-3-oxazolidinecarboxylic acid phenylmethyl ester
  • (2R, 4R) Z-5-OXAZOLIDINONE(2-PH, 4-ME)
  • benzyl (2R,4R)-4-methyl-5-oxo-2-phenyl-1,3-oxazolidine-3-carboxylate
Found 4 products.