CAS 143577-49-5

3H-Pyrrolo[1,2-c][1,2,3]oxathiazole, tetrahydro-, 1,1-dioxide

Description:

3H-Pyrrolo[1,2-c][1,2,3]oxathiazole, tetrahydro-, 1,1-dioxide, identified by its CAS number 143577-49-5, is a heterocyclic compound featuring a fused ring system that includes both nitrogen and sulfur atoms. This compound is characterized by its unique structural framework, which combines elements of pyrrole and oxathiazole, contributing to its potential reactivity and biological activity. The presence of the tetrahydro configuration indicates that the compound has undergone hydrogenation, resulting in a saturated structure that may influence its stability and solubility. The 1,1-dioxide functional group suggests the presence of two double-bonded oxygen atoms, which can enhance the compound's polar characteristics and may play a role in its interactions with biological targets. Such compounds are often of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. However, specific applications and biological effects would require further investigation through experimental studies.

Formula: C₅H₉NO₃S

InChI: InChI=1S/C5H9NO3S/c7-10(8)6-3-1-2-5(6)4-9-10/h5H,1-4H2

InChI key: InChIKey=WFFHPXGNIIMFHE-UHFFFAOYSA-N

SMILES: O=S1(=O)N2C(CO1)CCC2

Synonyms:

• 3H-Pyrrolo[1,2-c][1,2,3]oxathiazole, tetrahydro-, 1,1-dioxide

4,5,6-Tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide

CAS: 143577-49-5

4,5,6-Tetrahydro-3H-pyrrolo[1,2-c]oxathiazole 1,1-dioxide

Purity: ≥95%

Molecular weight: 163.19g/mol

Ref: 54-OR400828

Tetrahydro-​3H-​pyrrolo[1,​2-​c]​[1,​2,​3]​oxathiazole 1,​1-​dioxide

CAS: 143577-49-5

Versatile small molecule scaffold

Formula: C₅H₉NO₃S

Purity: Min. 95%

Molecular weight: 163.2 g/mol

Ref: 3D-TFA57749