CAS 1435804-70-8

1,2,4-Oxadiazole-5-ethanamine, 3-(2-furanyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-ethanamine, 3-(2-furanyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the furanyl group indicates that it has a furan ring, contributing to its aromatic properties and potential reactivity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The oxadiazole moiety is often associated with various pharmacological properties, including antimicrobial and anti-inflammatory activities. The specific arrangement of functional groups in this compound may also affect its interaction with biological targets, making it of interest in medicinal chemistry. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Overall, this substance represents a class of compounds that may have significant applications in drug development and materials science.

Formula: C₈H₉N₃O₂·ClH

InChI: InChI=1S/C8H9N3O2.ClH/c9-4-3-7-10-8(11-13-7)6-2-1-5-12-6;/h1-2,5H,3-4,9H2;1H

InChI key: InChIKey=LAQFJGOVMNRILP-UHFFFAOYSA-N

SMILES: C(CN)C1=NC(=NO1)C2=CC=CO2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-ethanamine, 3-(2-furanyl)-, hydrochloride (1:1)

2-(3-(furan-2-yl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride

CAS: 1435804-70-8

Formula: C₈H₁₀ClN₃O₂

Purity: 95.0%

Molecular weight: 215.64

Ref: 10-F496201