CAS 1435804-72-0

Acetamide, 2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and the presence of a phenyl-substituted oxadiazole moiety. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The hydrochloride form indicates that it is a salt, which often enhances solubility and stability in aqueous environments. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals, particularly in areas related to antimicrobial or anti-inflammatory activities. Additionally, the compound may exhibit specific melting and boiling points, as well as distinct spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.

Formula: C₁₁H₁₂N₄O₂·ClH

InChI: InChI=1S/C11H12N4O2.ClH/c12-6-9(16)13-7-10-14-11(15-17-10)8-4-2-1-3-5-8;/h1-5H,6-7,12H2,(H,13,16);1H

InChI key: InChIKey=SOFWAOUIOZDNNX-UHFFFAOYSA-N

SMILES: C(NC(CN)=O)C1=NC(=NO1)C2=CC=CC=C2.Cl

Synonyms:

• Acetamide, 2-amino-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-, hydrochloride (1:1)

2-amino-N-((3-phenyl-1,2,4-oxadiazol-5-yl)methyl)acetamide hydrochloride

CAS: 1435804-72-0

Formula: C₁₁H₁₃ClN₄O₂

Purity: 95.0%

Molecular weight: 268.7

Ref: 10-F496174