CymitQuimica logo

CAS 1435804-82-2

:

1-(1H-Benzimidazol-2-ylmethyl)cyclohexanamine

Description:
1-(1H-Benzimidazol-2-ylmethyl)cyclohexanamine is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety linked to a cyclohexanamine. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the benzimidazole ring suggests possible interactions with biological targets, as benzimidazoles are known for their roles in pharmaceuticals, particularly as anti-parasitic and anti-cancer agents. The cyclohexanamine portion may influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Additionally, the amine functional group can participate in hydrogen bonding, which may enhance its interactions with biological macromolecules. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation through experimental studies.
Formula:C14H19N3
InChI:InChI=1S/C14H19N3/c15-14(8-4-1-5-9-14)10-13-16-11-6-2-3-7-12(11)17-13/h2-3,6-7H,1,4-5,8-10,15H2,(H,16,17)
InChI key:InChIKey=BECHXKVTPZCYHM-UHFFFAOYSA-N
SMILES:C(C1(N)CCCCC1)C=2NC=3C(N2)=CC=CC3
Synonyms:
  • Cyclohexanamine, 1-(1H-benzimidazol-2-ylmethyl)-
  • 1-(1H-Benzimidazol-2-ylmethyl)cyclohexanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.