CymitQuimica logo

CAS 143591-61-1

:

3-bromo-8-chloroimidazo[1,2-a]pyrazine

Description:
3-Bromo-8-chloroimidazo[1,2-a]pyrazine is a heterocyclic compound characterized by its fused imidazole and pyrazine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 8 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, which is common for halogenated heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with imidazole and pyrazine derivatives. Additionally, the halogen substituents may influence its electronic properties and interactions with biological targets. As with many heterocycles, it may also exhibit interesting photophysical properties, making it a candidate for further research in materials science and organic electronics. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C6H3BrClN3
InChI:InChI=1/C6H3BrClN3/c7-4-3-10-6-5(8)9-1-2-11(4)6/h1-3H
InChI key:MCEGPQSPRNOFMG-UHFFFAOYSA-N
SMILES:c1cn2c(cnc2c(Cl)n1)Br
Synonyms:
  • Imidazo[1,2-A]Pyrazine, 3-Bromo-8-Chloro-
Found 4 products.