CAS 143592-06-7

8-CHLORO-2,3-DIHYDROIMIDAZO[1,2-A]PYRAZINE HYDROCHLORIDE

Description:

8-Chloro-2,3-dihydroimidazo[1,2-a]pyrazine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes both imidazole and pyrazine moieties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The chlorine substituent at the 8-position contributes to its reactivity and potential biological activity. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit effects on various biological targets. The compound's molecular formula reflects its composition, and its specific stereochemistry can influence its interactions in biological systems. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as well as any regulatory considerations associated with its use in research or pharmaceutical applications.

Formula: C₆H₇Cl₂N₃

InChI: InChI=1/C6H6ClN3.ClH/c7-5-6-9-2-4-10(6)3-1-8-5;/h1,3H,2,4H2;1H

SMILES: c1cn2CCN=c2c(Cl)n1.Cl

8-Chloro-2,3-dihydroimidazo[1,2-a]pyrazine hydrochloride

CAS: 143592-06-7

Formula: C₆H₇Cl₂N₃

Molecular weight: 192.0459

Ref: IN-DA00AD26

8-Chloro-2,3-dihydroimidazo[1,2-a]pyrazine hydrochloride

CAS: 143592-06-7

8-Chloro-2,3-dihydroimidazo[1,2-a]pyrazine hydrochloride

Purity: ≥95%

Molecular weight: 192.05g/mol

Ref: 54-OR27774