CAS 143601-09-6
:curculigoside B
Description:
Curculigoside B is a natural compound primarily derived from the plant Curculigo orchioides, which is known for its traditional medicinal uses. This substance belongs to the class of glycosides, characterized by the presence of a sugar moiety linked to a non-sugar component, typically an aglycone. Curculigoside B exhibits various biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects, making it of interest in pharmacological research. Its chemical structure features a specific arrangement of carbon, hydrogen, and oxygen atoms, contributing to its functional properties. The compound is often studied for its potential therapeutic applications, particularly in the context of neurodegenerative diseases and other health conditions. Additionally, curculigoside B may interact with various biological pathways, highlighting its significance in natural product chemistry and herbal medicine. As research continues, further elucidation of its mechanisms of action and potential benefits is anticipated, contributing to the understanding of its role in health and disease.
Formula:C21H24O11
InChI:InChI=1/C21H24O11/c1-29-14-4-2-3-12(24)16(14)20(28)30-9-10-7-11(23)5-6-13(10)31-21-19(27)18(26)17(25)15(8-22)32-21/h2-7,15,17-19,21-27H,8-9H2,1H3/t15-,17-,18-,19-,21-/m1/s1
Synonyms:- 2-(beta-D-allopyranosyloxy)-5-hydroxybenzyl 2-hydroxy-6-methoxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Hydroxy-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzyl 2-hydroxy-6-methoxybenzoate
CAS:Formula:C21H24O11Purity:98%Molecular weight:452.40875-Hydroxy-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzyl 2-hydroxy-6-methoxybenzoate
CAS:<p>5-Hydroxy-2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzyl 2-hydroxy-6-methoxybenzoate</p>Purity:99%Molecular weight:452.41g/molCurculigoside B
CAS:<p>Curculigoside B shows antioxidative and antiosteoporotic activities, it can decrease area of bone resorption pit, osteoclastic formation and TRAP activity.</p>Formula:C21H24O11Color and Shape:SolidMolecular weight:452.41Curculigoside B
CAS:<p>Natural phenol with activity against β-amyloid aggregation</p>Formula:C21H24O11Purity:Min. 95%Color and Shape:PowderMolecular weight:452.41 g/mol






