CAS 14369-94-9
:ethyl 4-oxoheptanoate
Description:
Ethyl 4-oxoheptanoate, with the CAS number 14369-94-9, is an organic compound that belongs to the class of esters. It is characterized by its structure, which includes a seven-carbon chain (heptanoate) with a ketone functional group (4-oxo) and an ethyl group attached to the carboxylic acid portion. This compound typically appears as a colorless to pale yellow liquid with a fruity odor, making it potentially useful in flavoring and fragrance applications. Ethyl 4-oxoheptanoate is soluble in organic solvents and exhibits moderate polarity due to the presence of both ester and ketone functionalities. Its boiling point and melting point are influenced by its molecular weight and structure, and it may undergo typical reactions associated with esters, such as hydrolysis and transesterification. Additionally, it may have applications in organic synthesis and as an intermediate in the production of various chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H16O3
InChI:InChI=1/C9H16O3/c1-3-5-8(10)6-7-9(11)12-4-2/h3-7H2,1-2H3
SMILES:CCCC(=O)CCC(=O)OCC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Heptanoic acid, 4-oxo-, ethyl ester
CAS:Formula:C9H16O3Purity:95%Color and Shape:LiquidMolecular weight:172.2215Ethyl 4-oxoheptanoate
CAS:Formula:C9H16O3Purity:97.0%Color and Shape:Liquid, OilMolecular weight:172.224Ethyl 4-oxoheptanoate
CAS:<p>Ethyl 4-oxoheptanoate (E4OH) is an inhibitor of tyrosine hydroxylase, which converts the amino acid tyrosine to the neurotransmitter L-DOPA. It is a trisubstituted, high stereoselective, and hydroxylase inhibitor. E4OH inhibits the enzyme tyrosine hydroxylase and prevents the synthesis of L-DOPA in a stereospecific manner. This compound also has been shown to inhibit diastereoisomeric synthses of L-DOPA.</p>Formula:C9H16O3Purity:Min. 95%Molecular weight:172.22 g/mol
