CAS 143696-74-6

2-(2,4-Dichlorophenyl)imidazo[1,2-a]pyrimidine

Description:

2-(2,4-Dichlorophenyl)imidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its imidazo and pyrimidine ring structures, which contribute to its biological activity. This compound features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which enhances its lipophilicity and potential interactions with biological targets. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the imidazo and pyrimidine moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often associated with various biological activities, including antimicrobial and anticancer properties. The compound's molecular structure allows for potential interactions with enzymes or receptors, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.

Formula: C₁₂H₇Cl₂N₃

InChI: InChI=1S/C12H7Cl2N3/c13-8-2-3-9(10(14)6-8)11-7-17-5-1-4-15-12(17)16-11/h1-7H

InChI key: InChIKey=LCGQJBUEYULFLW-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CN3C(=N2)N=CC=C3)C=CC(Cl)=C1

Synonyms:

• 2-(2,4-Dichlorophenyl)imidazo[1,2-a]pyrimidine
• Imidazo[1,2-a]pyrimidine, 2-(2,4-dichlorophenyl)-

2-(2,4-Dichlorophenyl)imidazo[1,2-a]pyrimidine

CAS: 143696-74-6

2-(2,4-Dichlorophenyl)imidazo[1,2-a]pyrimidine

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 264.11g/mol

Ref: 54-OR904606