CAS 1437-67-8

3-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]propanoic acid

Description:

3-[(1-phenyl-1H-tetrazol-5-yl)sulfanyl]propanoic acid, with the CAS number 1437-67-8, is a chemical compound characterized by its unique structure that includes a propanoic acid moiety linked to a phenyl-substituted tetrazole via a sulfanyl (thioether) group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the tetrazole ring contributes to its stability and reactivity, while the sulfanyl group can enhance its solubility and interaction with biological targets. The compound may also display interesting biological activities, which could be explored in medicinal chemistry. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point, solubility, and reactivity. Overall, this compound represents a fascinating example of a multifunctional organic molecule with potential applications in diverse fields.

Formula: C₁₀H₁₀N₄O₂S

InChI: InChI=1/C10H10N4O2S/c15-9(16)6-7-17-10-11-12-13-14(10)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,15,16)

SMILES: c1ccc(cc1)n1c(nnn1)SCCC(=O)O

Synonyms:

• propanoic acid, 3-[(1-phenyl-1H-tetrazol-5-yl)thio]-

3-((1-Phenyl-1H-tetrazol-5-yl)thio)propanoic acid

CAS: 1437-67-8

Formula: C₁₀H₁₀N₄O₂S

Molecular weight: 250.2770

Ref: IN-DA001I7J

3-[(1-phenyl-1H-tetrazol-5-yl)thio]propanoic acid

CAS: 1437-67-8

Formula: C₁₀H₁₀N₄O₂S

Purity: 95.0%

Molecular weight: 250.28

Ref: 10-F315144