CAS 14370-50-4
:Bicyclo[2.2.1]heptane-2-methanamine
Description:
Bicyclo[2.2.1]heptane-2-methanamine, with the CAS number 14370-50-4, is an organic compound characterized by its bicyclic structure, which consists of a seven-membered ring system. This compound features a methanamine functional group, indicating the presence of an amine (-NH2) attached to the bicyclic framework. The bicyclo[2.2.1]heptane structure contributes to its unique three-dimensional conformation, which can influence its reactivity and interaction with biological systems. Typically, compounds like this may exhibit properties such as moderate polarity due to the amine group, and they may participate in hydrogen bonding, affecting their solubility in various solvents. Additionally, the bicyclic nature can impart rigidity to the molecule, potentially influencing its pharmacological properties if used in medicinal chemistry. Overall, Bicyclo[2.2.1]heptane-2-methanamine is of interest in various fields, including organic synthesis and medicinal chemistry, due to its structural characteristics and potential applications.
Formula:C8H15N
InChI:InChI=1S/C8H15N/c9-5-8-4-6-1-2-7(8)3-6/h6-8H,1-5,9H2
InChI key:InChIKey=HWMZHVLJBQTGOL-UHFFFAOYSA-N
SMILES:C(N)C1C2CC(C1)CC2
Synonyms:- (Bicyclo[2.2.1]heptan-2-ylmethyl)amine
- 2-(Aminomethyl)bicyclo[2.2.1]heptane
- 2-(Aminomethyl)norbornane
- 2-Norbornanemethylamine
- 3-Bicyclo[2.2.1]heptanylmethanamine
- Bicyclo[2.2.1]Heptane-2-Methanamine
- Bicyclo[2.2.1]heptan-2-ylmethanamine
- NSC 35381
- Norbornylmethylamine
- [(Bicyclo[2.2.1]hept-2-yl)methyl]amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
