
CAS 143701-81-9
:2-(Methylsulfonyl)-4-(trifluoromethyl)benzoyl chloride
Description:
2-(Methylsulfonyl)-4-(trifluoromethyl)benzoyl chloride, with the CAS number 143701-81-9, is an organic compound characterized by the presence of a benzoyl chloride functional group, which is known for its reactivity in acylation reactions. This compound features a methylsulfonyl group and a trifluoromethyl group, both of which significantly influence its chemical properties and reactivity. The methylsulfonyl group contributes to the compound's polarity and potential for hydrogen bonding, while the trifluoromethyl group enhances its lipophilicity and can affect its electronic properties, making it a useful building block in medicinal chemistry and agrochemical applications. The presence of the chloride substituent indicates that it can participate in nucleophilic substitution reactions, making it a versatile intermediate for synthesizing various derivatives. Additionally, due to the presence of fluorine atoms, the compound may exhibit unique biological activities and stability characteristics, which are often explored in drug development and material science. Proper handling and storage are essential due to its reactive nature and potential hazards associated with chlorinated compounds.
Formula:C9H6ClF3O3S
InChI:InChI=1S/C9H6ClF3O3S/c1-17(15,16)7-4-5(9(11,12)13)2-3-6(7)8(10)14/h2-4H,1H3
InChI key:InChIKey=SSFHJYALDMCLPO-UHFFFAOYSA-N
SMILES:S(C)(=O)(=O)C1=C(C(Cl)=O)C=CC(C(F)(F)F)=C1
Synonyms:- 2-(Methylsulfonyl)-4-(trifluoromethyl)benzoyl chloride
- Benzoyl chloride, 2-(methylsulfonyl)-4-(trifluoromethyl)-
- 2-Methylsulfonyl-4-trifluoromethylbenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Methylsulfonyl)-4-(trifluoromethyl)benzoyl chloride
CAS:Formula:C9H6ClF3O3SMolecular weight:286.6553
