CAS 143716-62-5: 2',4'-dinitrophenyl 2-deoxy-2-fluorogalactopyranoside

Description:2',4'-Dinitrophenyl 2-deoxy-2-fluorogalactopyranoside is a synthetic compound that serves as a glycoside derivative, specifically a fluorinated sugar. It features a dinitrophenyl group, which is known for its strong electron-withdrawing properties, enhancing the compound's reactivity and making it useful in various biochemical applications. The presence of the 2-deoxy-2-fluoro modification indicates that the hydroxyl group at the second carbon of the galactopyranose ring is replaced by a fluorine atom, which can influence the compound's biological activity and stability. This compound is often utilized in glycosylation reactions and as a substrate in enzyme assays, particularly in studies involving glycosidases. Its unique structural characteristics allow it to participate in specific interactions with enzymes, making it valuable in research related to carbohydrate chemistry and enzymology. Additionally, the dinitrophenyl moiety can facilitate detection methods, such as spectrophotometry, due to its chromophoric properties. Overall, this compound is significant in both synthetic and analytical chemistry contexts.

Formula:C₁₂H₁₃FN₂O₉

InChI:InChI=1/C12H13FN2O9/c13-9-11(18)10(17)8(4-16)24-12(9)23-7-2-1-5(14(19)20)3-6(7)15(21)22/h1-3,8-12,16-18H,4H2/t8-,9-,10+,11-,12-/m1/s1