CAS 1437312-09-8
:2-(6-Bromo-2-pyridinyl)hydrazinecarboxaldehyde
Description:
2-(6-Bromo-2-pyridinyl)hydrazinecarboxaldehyde is a chemical compound characterized by its unique structure, which includes a hydrazinecarboxaldehyde functional group attached to a pyridine ring that is substituted with a bromine atom. This compound typically exhibits properties associated with both hydrazine derivatives and aldehydes, such as reactivity towards electrophiles and nucleophiles. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the pyridine ring contributes to its aromaticity and may affect its solubility in organic solvents. This compound may also have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with hydrazine derivatives. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C6H6BrN3O
InChI:InChI=1S/C6H6BrN3O/c7-5-2-1-3-6(9-5)10-8-4-11/h1-4H,(H,8,11)(H,9,10)
InChI key:InChIKey=GEDQLHNATGDFDT-UHFFFAOYSA-N
SMILES:N(NC=O)C=1N=C(Br)C=CC1
Synonyms:- 2-(6-Bromo-2-pyridinyl)hydrazinecarboxaldehyde
- Hydrazinecarboxaldehyde, 2-(6-bromo-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.