CAS 143767-98-0

1-(2-Phenylethynyl)cyclohexanamine

Description:

1-(2-Phenylethynyl)cyclohexanamine, identified by its CAS number 143767-98-0, is an organic compound characterized by its unique structure that includes a cyclohexane ring and a phenylethynyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the phenylethynyl moiety contributes to its potential as a building block in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential applications in areas such as material science and drug development, where the interaction of the cyclohexane ring with various functional groups can lead to diverse biological activities. Additionally, the compound may exhibit specific physical properties, including melting and boiling points, which are influenced by its molecular weight and intermolecular forces. Overall, 1-(2-Phenylethynyl)cyclohexanamine is a compound of interest for further research and application in various chemical fields.

Formula: C₁₄H₁₇N

InChI: InChI=1S/C14H17N/c15-14(10-5-2-6-11-14)12-9-13-7-3-1-4-8-13/h1,3-4,7-8H,2,5-6,10-11,15H2

InChI key: InChIKey=ZKXQPWSHLFZUAF-UHFFFAOYSA-N

SMILES: C(#CC1=CC=CC=C1)C2(N)CCCCC2

Synonyms:

• Cyclohexanamine, 1-(phenylethynyl)-
• 1-(2-Phenylethynyl)cyclohexanamine
• Cyclohexanamine, 1-(2-phenylethynyl)-
• 1-(2-Phenylethynyl)cyclohexan-1-amine

1-(2-Phenylethynyl)cyclohexanamine

Controlled Product

CAS: 143767-98-0

Applications 1-(2-Phenylethynyl)cyclohexanamine is a reactant that functions as a catalyst in the cyclization of propargylamines.
References Zhao, D. et al.: ChemCatChem., 9, 4598 (2017); Yuan, R. et al.: J. Org. Chem., 82, 3639 (2017);

Formula: C₁₄H₁₇N

Color and Shape: Neat

Molecular weight: 199.292

Ref: TR-P400070