CAS 1437794-84-7

6-Quinolinesulfonic acid, 1,2,3,4-tetrahydro-2-oxo-, hydrate (1:1)

Description:

6-Quinolinesulfonic acid, 1,2,3,4-tetrahydro-2-oxo-, hydrate (1:1) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance typically exhibits properties associated with sulfonic acids, such as being a strong acid and having good solubility in polar solvents due to the presence of the sulfonic acid group. The tetrahydro-2-oxo moiety indicates that it has a saturated ring structure with a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. As a hydrate, it contains water molecules in its crystalline structure, which can influence its stability and solubility. This compound may be utilized in various chemical reactions, including as a reagent in organic synthesis or as an intermediate in the production of pharmaceuticals. Its specific applications and behavior can vary based on the conditions of use, such as pH and temperature. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₉NO₄S·H₂O

InChI: InChI=1S/C9H9NO4S.H2O/c11-9-4-1-6-5-7(15(12,13)14)2-3-8(6)10-9;/h2-3,5H,1,4H2,(H,10,11)(H,12,13,14);1H2

InChI key: InChIKey=RCIRKOPYWNTAJF-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C=1C=C2C(=CC1)NC(=O)CC2.O

Synonyms:

• 6-Quinolinesulfonic acid, 1,2,3,4-tetrahydro-2-oxo-, hydrate (1:1)