CAS 14379-00-1

Croconic acid disodium salt

Description:

Croconic acid disodium salt, with the CAS number 14379-00-1, is a chemical compound derived from croconic acid, which is known for its unique structural properties and potential applications in various fields. This disodium salt is characterized by its solubility in water, making it useful in aqueous solutions. It typically exhibits a bright yellow color, which is attributed to its conjugated system of double bonds, contributing to its potential as a dye or pigment. The compound is often studied for its electronic properties and has been explored in organic electronics and photonic applications. Additionally, croconic acid disodium salt may exhibit interesting acid-base behavior due to the presence of carboxylate groups, which can participate in various chemical reactions. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, croconic acid disodium salt is a compound of interest in both academic research and industrial applications due to its distinctive properties and versatility.

Formula: C₅Na₂O₅

InChI: InChI=1/C5H2O5.2Na/c6-1-2(7)4(9)5(10)3(1)8;;/h6-7H;;/q;2*+1/p-2

SMILES: C1(=C(C(=O)C(=O)C1=O)O)O.[Na].[Na]

Synonyms:

• (3,4,5-Trioxo-2-Sodiooxy-1-Cyclopentenyl)Oxysodium

Croconic acid disodium salt, 97%

CAS: 14379-00-1

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₅Na₂O₅

Purity: 97%

Color and Shape: Yellow to yellow-orange or yellow-green, Powder

Molecular weight: 186.03

Ref: 02-B22235

4,5-Dihydroxy-4-cyclopentene-1,2,3-trione disodium salt

CAS: 14379-00-1

Formula: C₅Na₂O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.0300

Ref: IN-DA001IDR

Croconic Acid Disodium Salt

CAS: 14379-00-1

Croconic Acid Disodium Salt

Purity: 97%

Molecular weight: 186.03g/mol

Ref: 54-OR1026935

Croconic acid (disodium)

CAS: 14379-00-1

Purity: 97%

Molecular weight: 185.95

Ref: 10-F556723

Croconic acid disodium

CAS: 14379-00-1

Croconic acid (disodium) (Nacr) enhances gene expression related to lysine crotonylation (Kcr) modification, which promotes cell growth and proliferation. This compound also shows promise in boosting somatic cell nuclear transfer (SCNT) efficiency and optimizing research in cell culture conditions.

Formula: C₅Na₂O₅

Color and Shape: Solid

Molecular weight: 186.03

Ref: TM-T200032