CAS 14379-76-1

glycyl-glycyl-proline

Description:

Glycyl-glycyl-proline, also known by its CAS number 14379-76-1, is a tripeptide composed of three amino acids: two glycine residues and one proline residue. This compound is characterized by its relatively simple structure, which contributes to its unique properties. Glycyl-glycyl-proline exhibits a high degree of solubility in water due to the presence of polar amino acid side chains, making it suitable for various biochemical applications. The presence of proline introduces a distinctive cyclic structure that can influence the peptide's conformation and stability, often resulting in a rigid structure compared to other peptides. This rigidity can affect its biological activity, including its role in protein folding and stability. Glycyl-glycyl-proline may also participate in various biochemical processes, including acting as a signaling molecule or influencing cellular functions. Its synthesis can be achieved through solid-phase peptide synthesis or other peptide coupling methods, making it accessible for research and potential therapeutic applications.

Formula: C₉H₁₅N₃O₄

InChI: InChI=1/C9H15N3O4/c10-4-7(13)11-5-8(14)12-3-1-2-6(12)9(15)16/h6H,1-5,10H2,(H,11,13)(H,15,16)

SMILES: C1CC(C(=O)O)N(C1)C(=O)CN=C(CN)O

Synonyms:

• Gly-gly-pro
• L-Proline, 1-(N-glycylglycyl)-
• glycylglycyl-L-proline
• Glycyl-glycyl-proline

H-Gly-Gly-Pro-OH

CAS: 14379-76-1

H-Gly-Gly-Pro-OH

Purity: ≥95%

Molecular weight: 229.23g/mol

Ref: 54-BUP11238

H-Gly-Gly-Pro-OH

CAS: 14379-76-1

H-Gly-Gly-Pro-OH (Glycyl-glycyl-L-proline) is a dipeptide composed of glycine and proline, and is an end product of collagen metabolism.

Formula: C₉H₁₅N₃O₄

Purity: 97.44%

Color and Shape: Solid

Molecular weight: 229.23

Ref: TM-TP1156

H-Gly-Gly-Pro-OH

CAS: 14379-76-1

Purity: 97%

Molecular weight: 229.11

Ref: 10-F554600

H-Gly-Gly-Pro-OH

CAS: 14379-76-1

H-Gly-Gly-Pro-OH is a recombinant polypeptide with affinity for amino acids. It is a positionally defined sequence of amino acids that has been shown to bind to Alzheimer's disease (AD) amyloid peptides and inhibit the formation of beta amyloid fibrils. The N-terminal sequence of this polypeptide is immunogenic, which may be useful for generating antibodies against AD.

Formula: C₉H₁₅N₃O₄

Purity: Min. 95%

Molecular weight: 229.23 g/mol

Ref: 3D-FG109016