CAS 143790-05-0
:2',3'-dideoxy-5-fluoro-3'-thiauridine
Description:
2',3'-Dideoxy-5-fluoro-3'-thiauridine, with the CAS number 143790-05-0, is a synthetic nucleoside analog that exhibits antiviral properties, particularly against certain viruses such as HIV. This compound is characterized by the presence of a sulfur atom in its sugar moiety, which differentiates it from standard nucleosides. The substitution of a fluorine atom at the 5-position of the uracil base enhances its biological activity and stability. As a dideoxynucleoside, it lacks the hydroxyl groups at the 2' and 3' positions of the ribose sugar, which is crucial for its mechanism of action as a chain terminator during viral RNA synthesis. This structural modification allows it to interfere with viral replication. The compound is typically studied for its potential therapeutic applications in antiviral treatments and is of interest in medicinal chemistry for its unique properties and mechanisms. Its pharmacokinetics, toxicity, and efficacy are subjects of ongoing research to optimize its use in clinical settings.
Formula:C8H9FN2O4S
InChI:InChI=1/C8H9FN2O4S/c9-4-1-11(8(14)10-7(4)13)5-3-16-6(2-12)15-5/h1,5-6,12H,2-3H2,(H,10,13,14)/t5-,6+/m0/s1
Synonyms:- cis 5-Fluoro-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2,4(1H,3H)-pyrimidinedione-13C,15N2
- cis-(+/-)-Fluoro-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2,4(1H,3H)-pyrimidinedione-13C,15N2
- Ftu-13C,15N2
- 5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidine-2,4(1H,3H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Emtricitabine Impurity 32
CAS:Formula:C8H9FN2O4SColor and Shape:White To Off-White SolidMolecular weight:248.23

