CAS 143805-78-1

(3-BROMOMETHYLPHENYL)BORONIC ACID NEOPENTYL GLYCOL ESTER

Description:

(3-Bromomethylphenyl)boronic acid neopentyl glycol ester is a boronic acid derivative characterized by the presence of a bromomethyl group attached to a phenyl ring and an ester functional group derived from neopentyl glycol. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible complexes with diols, making it useful in various organic synthesis applications, particularly in Suzuki coupling reactions. The presence of the bromomethyl group enhances its reactivity, allowing for further functionalization. Additionally, the neopentyl glycol ester moiety contributes to its solubility and stability in organic solvents. This compound is often utilized in the development of pharmaceuticals and agrochemicals due to its versatile reactivity and ability to serve as a building block in complex organic molecules. Safety data sheets should be consulted for handling and storage guidelines, as boronic acids can pose health risks if not managed properly. Overall, this compound exemplifies the utility of boronic acids in modern synthetic chemistry.

Formula: C₁₂H₁₆BBrO₂

InChI: InChI=1/C12H16BBrO2/c1-12(2)8-15-13(16-9-12)11-5-3-4-10(6-11)7-14/h3-6H,7-9H2,1-2H3

SMILES: CC1(C)COB(c2cccc(c2)CBr)OC1

Synonyms:

• 3-Bromomethylbenzeneboronic Acid, Neopentyl Glycol Ester
• 3-(Bromomethyl)benzeneboronic acid, neopentyl glycol ester 95%
• 2-[3-(Bromomethyl)Phenyl]-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane
• 2-[3-(Bromomethyl)Phenyl]-5,5-Dimethyl-1,3,2-Dioxaborinane

1,​3,​2-​Dioxaborinane, 2-​[4-​(bromomethyl)​phenyl]​-​5,​5-​dimethyl-

CAS: 143805-78-1

Formula: C₁₂H₁₆BBrO₂

Purity: %

Color and Shape: Solid

Molecular weight: 282.9692

Ref: IN-DA001IDZ

(4-Bromomethylphenyl)boronic acid neopentyl glycol ester

CAS: 143805-78-1

(4-Bromomethylphenyl)boronic acid neopentyl glycol ester

Purity: 99%

Molecular weight: 282.97g/mol

Ref: 54-OR360017