CAS 1438241-27-0

1,1-Dimethylethyl 3a-aminohexahydrocyclopenta[b]pyrrole-1(2H)-carboxylate

Description:

1,1-Dimethylethyl 3a-aminohexahydrocyclopenta[b]pyrrole-1(2H)-carboxylate, identified by its CAS number 1438241-27-0, is a chemical compound that features a complex structure characterized by a cyclopentane ring fused with a pyrrole moiety. This compound contains a dimethyl group, which contributes to its steric properties, and an amino group that may participate in various chemical reactions, including hydrogen bonding and nucleophilic attacks. The carboxylate functional group indicates that it can exist in both protonated and deprotonated forms, influencing its solubility and reactivity in different environments. The presence of multiple functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's stereochemistry and spatial arrangement may play a crucial role in its biological activity and interactions with other molecules. Overall, this compound exemplifies the complexity and diversity of organic molecules, with implications for research in various fields, including drug design and synthetic chemistry.

Formula: C₁₂H₂₂N₂O₂

InChI: InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-8-7-12(13)6-4-5-9(12)14/h9H,4-8,13H2,1-3H3

InChI key: InChIKey=TUBKTTUXJKGATN-UHFFFAOYSA-N

SMILES: NC12C(N(C(OC(C)(C)C)=O)CC1)CCC2

Synonyms:

• Cyclopenta[b]pyrrole-1(2H)-carboxylic acid, 3a-aminohexahydro-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3a-aminohexahydrocyclopenta[b]pyrrole-1(2H)-carboxylate

tert-Butyl 3a-aminohexahydrocyclopenta[b]pyrrole-1(2H)-carboxylate

CAS: 1438241-27-0

Versatile small molecule scaffold

Formula: C₁₂H₂₂N₂O₂

Purity: Min. 95%

Molecular weight: 226.32 g/mol

Ref: 3D-NHC24127