CAS 143832-52-4

(3-amino-1H-1,2,4-triazol-5-yl)acetic acid

Description:

(3-amino-1H-1,2,4-triazol-5-yl)acetic acid is a chemical compound characterized by its triazole ring structure, which contributes to its unique chemical properties. This compound features an amino group and a carboxylic acid group, making it an amino acid derivative. The presence of the triazole ring imparts potential biological activity, as triazoles are known for their role in various pharmacological applications, including antifungal and antimicrobial properties. The compound is typically a white to off-white solid and is soluble in polar solvents due to its functional groups. Its molecular structure allows for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, (3-amino-1H-1,2,4-triazol-5-yl)acetic acid may exhibit zwitterionic behavior in solution, depending on the pH, which can affect its stability and solubility. Overall, this compound is of interest in both synthetic chemistry and potential therapeutic applications, warranting further investigation into its properties and uses.

Formula: C₄H₆N₄O₂

InChI: InChI=1/C4H6N4O2/c5-4-6-2(7-8-4)1-3(9)10/h1H2,(H,9,10)(H3,5,6,7,8)

SMILES: C(c1nc(=N)[nH][nH]1)C(=O)O

Synonyms:

• (5-Amino-4H-1,2,4-triazol-3-yl)acetic acid
• 1H-1,2,4-triazole-3-acetic acid, 5-amino-
• 1H-1,2,4-triazole-5-acetic acid, 3-amino-
• 4H-1,2,4-Triazole-3-acetic acid, 5-amino-

1H-1,2,4-Triazole-3-acetic acid, 5-amino-

CAS: 143832-52-4

Formula: C₄H₆N₄O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 142.1160

Ref: IN-DA001IG8

2-(5-Amino-1H-1,2,4-Triazol-3-Yl)Acetic Acid

CAS: 143832-52-4

2-(5-Amino-1H-1,2,4-Triazol-3-Yl)Acetic Acid

Purity: 98%

Molecular weight: 142.12g/mol

Ref: 54-OR1030394

(5-Amino-4H-[1,2,4]triazol-3-yl)-acetic acid

CAS: 143832-52-4

Formula: C₄H₆N₄O₂

Purity: 97%

Color and Shape: Solid, No data available.

Molecular weight: 142.118

Ref: 10-F028640